EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O6 |
| Net Charge | 0 |
| Average Mass | 350.326 |
| Monoisotopic Mass | 350.07904 |
| SMILES | O=C1C=Cc2c3c4c(c(O)ccc4c4ccc(O)c1c24)[C@H](O)[C@H](O)[C@H]3O |
| InChI | InChI=1S/C20H14O6/c21-10-4-1-7-8-2-5-12(23)17-14(8)15(18(24)20(26)19(17)25)9-3-6-11(22)16(10)13(7)9/h1-6,18-21,23-26H/t18-,19-,20+/m0/s1 |
| InChIKey | LYFFSXMYKSNTOT-SLFFLAALSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria (ncbitaxon:5598) | - | PubMed (28300771) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,11alpha,12beta,13beta,16-pentahydroxy-11,12-dihydroperylen-6(13H)-one (CHEBI:212456) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (10S,11R,12S)-4,9,10,11,12-pentahydroxy-11,12-dihydro-10H-perylen-3-one |
| Manual Xrefs | Databases |
|---|---|
| 61708486 | ChemSpider |