EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H33N3O8 |
| Net Charge | 0 |
| Average Mass | 455.508 |
| Monoisotopic Mass | 455.22677 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@H](CO)[C@H](O)[C@H](O)[C@@H](O)C(=O)N[C@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H33N3O8/c1-11(2)8-13(22)20(31)24-15(10-25)17(28)18(29)19(30)21(32)23-14(9-16(26)27)12-6-4-3-5-7-12/h3-7,11,13-15,17-19,25,28-30H,8-10,22H2,1-2H3,(H,23,32)(H,24,31)(H,26,27)/t13-,14+,15+,17-,18-,19+/m0/s1 |
| InChIKey | PSSAPTMCCOBBEJ-ZXPQYSFNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillusspecies (in: firmicutes) (ncbitaxon:1409) | - | PubMed (11827035) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyloricidin C (CHEBI:212452) is a benzenes (CHEBI:22712) |
| Pyloricidin C (CHEBI:212452) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (3R)-3-[[(2R,3S,4S,5R)-5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438546 | ChemSpider |