EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N6O7S |
| Net Charge | 0 |
| Average Mass | 352.329 |
| Monoisotopic Mass | 352.08012 |
| SMILES | NC1=N[C@H]2[C@H](CO)N=C(N)N3C[C@H](OS(=O)(=O)O)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C9H16N6O7S/c10-6-13-5-3(2-16)12-7(11)15-1-4(22-23(19,20)21)9(17,18)8(5,15)14-6/h3-5,16-18H,1-2H2,(H2,11,12)(H3,10,13,14)(H,19,20,21)/t3-,4-,5-,8-/m0/s1 |
| InChIKey | AJLCXXKDNUGKKH-RGDLXGNYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microseira wollei (ncbitaxon:467598) | - | PubMed (9407557) |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Decarbamoylgonyautoxin-3 (CHEBI:212434) has role marine metabolite (CHEBI:76507) |
| Decarbamoylgonyautoxin-3 (CHEBI:212434) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] hydrogen sulate |
| Manual Xrefs | Databases |
|---|---|
| 95600552 | ChemSpider |