EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O3 |
| Net Charge | 0 |
| Average Mass | 250.298 |
| Monoisotopic Mass | 250.13174 |
| SMILES | CC(=NCC(C)(C)O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C13H18N2O3/c1-9(14-8-13(2,3)18)15-11-7-5-4-6-10(11)12(16)17/h4-7,18H,8H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | CKZIANKHOZUABY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (23966037) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penipacid A (CHEBI:212401) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 2-[[N-(2-hydroxy-2-methylpropyl)-C-methylcarbonimidoyl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30771321 | ChemSpider |