EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N4O4 |
| Net Charge | 0 |
| Average Mass | 490.604 |
| Monoisotopic Mass | 490.25801 |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)N(C)[C@@H](Cc1ccc(O)cc1)C(=O)N/C=C\c1cnc2ccccc12 |
| InChI | InChI=1S/C28H34N4O4/c1-5-18(2)26(31-19(3)33)28(36)32(4)25(16-20-10-12-22(34)13-11-20)27(35)29-15-14-21-17-30-24-9-7-6-8-23(21)24/h6-15,17-18,25-26,30,34H,5,16H2,1-4H3,(H,29,35)(H,31,33)/b15-14-/t18-,25-,26-/m0/s1 |
| InChIKey | NZRQIPUGMHEHIL-AQFPYVEVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1016/S1875-5364(19)30017-2) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspergillamide C (CHEBI:212386) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,3S)-2-acetamido-N-[(2S)-3-(4-hydroxyphenyl)-1-[[(Z)-2-(1H-indol-3-yl)ethenyl]amino]-1-oxopropan-2-yl]-N,3-dimethylpentanamide |