EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O10 |
| Net Charge | 0 |
| Average Mass | 432.381 |
| Monoisotopic Mass | 432.10565 |
| SMILES | COC(=O)C[C@@H]1O[C@@]2(O[C@@H](C)CC(=O)[C@H]2O)C2=C(C(=O)c3cccc(O)c3C2=O)[C@@H]1O |
| InChI | InChI=1S/C21H20O10/c1-8-6-11(23)20(28)21(30-8)16-15(18(26)12(31-21)7-13(24)29-2)17(25)9-4-3-5-10(22)14(9)19(16)27/h3-5,8,12,18,20,22,26,28H,6-7H2,1-2H3/t8-,12-,18+,20+,21-/m0/s1 |
| InChIKey | QGLJKFQKQQJESJ-ISQBSFMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsisspecies (ncbitaxon:310350) | - | PubMed (18277001) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Griseusin D (CHEBI:212383) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| methyl 2-[(1S,3S,3'R,4S,6'S)-3',4,9-trihydroxy-6'-methyl-4',5,10-trioxospiro[3,4-dihydrobenzo[g]isochromene-1,2'-oxane]-3-yl]acetate |
| Manual Xrefs | Databases |
|---|---|
| 78441114 | ChemSpider |