EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO3 |
| Net Charge | 0 |
| Average Mass | 223.272 |
| Monoisotopic Mass | 223.12084 |
| SMILES | O=C(O)CC(=O)C1=CCCC[C@@H]2CC[C@H]1N2 |
| InChI | InChI=1S/C12H17NO3/c14-11(7-12(15)16)9-4-2-1-3-8-5-6-10(9)13-8/h4,8,10,13H,1-3,5-7H2,(H,15,16)/t8-,10-/m1/s1 |
| InChIKey | WYNQRSDHALABAA-PSASIEDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aphanizomenon (ncbitaxon:1175) | - | PubMed (17310714) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-Carboxyl anatoxin A (CHEBI:212356) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 3-[(1R,7R)-10-azabicyclo[5.2.1]dec-2-en-2-yl]-3-oxopropanoic acid |