EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O4 |
| Net Charge | 0 |
| Average Mass | 260.289 |
| Monoisotopic Mass | 260.10486 |
| SMILES | C=C=CCOc1ccc(/C=C/C(=O)OC)cc1OC |
| InChI | InChI=1S/C15H16O4/c1-4-5-10-19-13-8-6-12(11-14(13)17-2)7-9-15(16)18-3/h5-9,11H,1,10H2,2-3H3/b9-7+ |
| InChIKey | IHEOIJMPDMHWKQ-VQHVLOKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylariaspecies (ncbitaxon:1715255) | - | PubMed (18569699) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7E)-3-(4-buta-2,3-dienyloxy-3-methoxy-phenyl)-acrylic acid methyl ester (CHEBI:212348) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| 23286359 | ChemSpider |