EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC1OC[C@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a211h-1x_1-5]/1/ |
| InChI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5?/m0/s1 |
| InChIKey | SRBFZHDQGSBBOR-HWQSCIPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-arabinopyranose (CHEBI:17535) has role Escherichia coli metabolite (CHEBI:76971) |
| L-arabinopyranose (CHEBI:17535) has role mouse metabolite (CHEBI:75771) |
| L-arabinopyranose (CHEBI:17535) is a L-arabinose (CHEBI:30849) |
| Incoming Relation(s) |
| 4-amino-4-deoxy-L-arabinopyranose (CHEBI:46991) has functional parent L-arabinopyranose (CHEBI:17535) |
| agrocinopine A (CHEBI:82804) has functional parent L-arabinopyranose (CHEBI:17535) |
| agrocinopine B (CHEBI:82806) has functional parent L-arabinopyranose (CHEBI:17535) |
| α-L-arabinopyranose (CHEBI:46987) is a L-arabinopyranose (CHEBI:17535) |
| β-L-arabinopyranose (CHEBI:40886) is a L-arabinopyranose (CHEBI:17535) |
| IUPAC Name |
|---|
| L-arabinopyranose |
| Synonyms | Source |
|---|---|
| L-Arabinose | KEGG COMPOUND |
| L-Arabinopyranose | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| L-arabinose | UniProt |
| Citations |
|---|