EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO7 |
| Net Charge | 0 |
| Average Mass | 363.366 |
| Monoisotopic Mass | 363.13180 |
| SMILES | C=C1[C@H](OC(C)=O)[C@]2(C(=O)N1OC)C1OC(C=C1OC(C)=O)[C@H]2/C=C/C |
| InChI | InChI=1S/C18H21NO7/c1-6-7-12-13-8-14(24-10(3)20)16(26-13)18(12)15(25-11(4)21)9(2)19(23-5)17(18)22/h6-8,12-13,15-16H,2H2,1,3-5H3/b7-6+/t12-,13?,15+,16?,18+/m1/s1 |
| InChIKey | SFPQBIKASSTKBL-XFUOYAIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylotrichum coccosporum (ncbitaxon:370955) | - | DOI (10.1002/hlca.19890720529) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spirostaphylotrichin M diacetat (4R*,5S) (CHEBI:212300) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [(3'R,5S,6S)-2-acetyloxy-1'-methoxy-2'-methylidene-5'-oxo-5-[(E)-prop-1-enyl]spiro[7-oxabicyclo[2.2.1]hept-2-ene-6,4'-pyrrolidine]-3'-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 78438545 | ChemSpider |