EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40N8O13 |
| Net Charge | 0 |
| Average Mass | 636.616 |
| Monoisotopic Mass | 636.27148 |
| SMILES | NCCCCNC(=O)[C@H](CCCN(O)C=O)NC(=O)[C@H](CO)NC(=O)[C@H](NC(=O)[C@H](CCC[N+](=O)[O-])NC=O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C23H40N8O13/c24-7-1-2-8-25-19(36)15(6-3-9-30(42)13-34)27-21(38)16(11-32)28-22(39)17(18(35)23(40)41)29-20(37)14(26-12-33)5-4-10-31(43)44/h12-18,32,35,42H,1-11,24H2,(H,25,36)(H,26,33)(H,27,38)(H,28,39)(H,29,37)(H,40,41)/t14-,15-,16-,17+,18+/m0/s1 |
| InChIKey | SFTPYNFMHUKKSK-NNPSNHGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia mallei (ncbitaxon:13373) | - | PubMed (23821334) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malleobactin A (CHEBI:212275) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2R,3R)-4-[[(2S)-1-[[(2S)-1-(4-aminobutylamino)-5-[ormyl(hydroxy)amino]-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-[[(2S)-2-ormamido-5-nitropentanoyl]amino]-2-hydroxy-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437465 | ChemSpider |