EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H10N2O4 |
| Net Charge | 0 |
| Average Mass | 318.288 |
| Monoisotopic Mass | 318.06406 |
| SMILES | Cc1cc(O)c2c3c(=O)c4cccc(O)c4c=3c(=O)c(=[N+]=[N-])c2c1 |
| InChI | InChI=1S/C18H10N2O4/c1-7-5-9-13(11(22)6-7)14-15(18(24)16(9)20-19)12-8(17(14)23)3-2-4-10(12)21/h2-6,21-22H,1H3 |
| InChIKey | OWPHUUBRUYFHMJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces murayamaensis (ncbitaxon:224537) | - | DOI (10.1021/ja001631w) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoprekinamycin (CHEBI:212252) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 5-diazo-1,7-dihydroxy-3-methylbenzo[a]luorene-6,11-dione |
| Manual Xrefs | Databases |
|---|---|
| 28284299 | ChemSpider |