EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46O3 |
| Net Charge | 0 |
| Average Mass | 466.706 |
| Monoisotopic Mass | 466.34470 |
| SMILES | CC1=C(C)[C@H](C[C@@H](C)[C@H]2CC[C@@]3(C)C4=C(CC[C@]23C)[C@@]2(C)CCC(=O)C(C)(C)[C@@H]2CC4)OC1=O |
| InChI | InChI=1S/C31H46O3/c1-18(17-24-19(2)20(3)27(33)34-24)21-11-15-31(8)23-9-10-25-28(4,5)26(32)13-14-29(25,6)22(23)12-16-30(21,31)7/h18,21,24-25H,9-17H2,1-8H3/t18-,21-,24+,25+,29-,30-,31+/m1/s1 |
| InChIKey | LMVVFTFLNDWZJC-VOIUCBJCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodofomes cajanderi (ncbitaxon:2066993) | - | PubMed (16835094) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-methyl-lanost-8,24-dien-23S,26-lactone (CHEBI:212186) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (2S)-3,4-dimethyl-2-[(2R)-2-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propyl]-2H-uran-5-one |
| Manual Xrefs | Databases |
|---|---|
| 78437462 | ChemSpider |