EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O2 |
| Net Charge | 0 |
| Average Mass | 234.299 |
| Monoisotopic Mass | 234.13683 |
| SMILES | CNc1ccc(C[C@H](NC(C)=O)C(C)=O)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-9(16)13(15-10(2)17)8-11-4-6-12(14-3)7-5-11/h4-7,13-14H,8H2,1-3H3,(H,15,17)/t13-/m0/s1 |
| InChIKey | RCQHFZLSWKECHK-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (27727167) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-1S-(4-methylaminophenylmethyl)-2-oxo-propyl acetamide (CHEBI:212161) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| N-[(2S)-1-[4-(methylamino)phenyl]-3-oxobutan-2-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 58197363 | ChemSpider |