EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O5 |
| Net Charge | 0 |
| Average Mass | 266.253 |
| Monoisotopic Mass | 266.09027 |
| SMILES | O=C(O)C[C@@H]1[C@@H](C(=O)O)NC[C@@H]1c1ccc(=O)nc1 |
| InChI | InChI=1S/C12H14N2O5/c15-9-2-1-6(4-13-9)8-5-14-11(12(18)19)7(8)3-10(16)17/h1-2,4,7-8,11,14H,3,5H2,(H,13,15)(H,16,17)(H,18,19)/t7-,8+,11-/m0/s1 |
| InChIKey | IZOVOLIVYUHJAA-RNSXUZJQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paralepistopsis acromelalga (ncbitaxon:439023) | - | DOI (10.1016/s0040-4039(00)97501-4) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acromelic acid C (CHEBI:212144) is a dicarboxylic acid (CHEBI:35692) |
| Acromelic acid C (CHEBI:212144) is a proline derivative (CHEBI:26273) |
| Acromelic acid C (CHEBI:212144) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| IUPAC Name |
|---|
| (2S,3S,4S)-3-(carboxymethyl)-4-(6-oxo-1H-pyridin-3-yl)pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 156023 | ChemSpider |