EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N4O9 |
| Net Charge | 0 |
| Average Mass | 554.641 |
| Monoisotopic Mass | 554.29518 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)C(C)C)C(=O)N[C@H](CO)[C@H](O)[C@H](O)[C@@H](O)C(=O)N[C@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C26H42N4O9/c1-13(2)10-17(29-25(38)20(27)14(3)4)24(37)30-18(12-31)21(34)22(35)23(36)26(39)28-16(11-19(32)33)15-8-6-5-7-9-15/h5-9,13-14,16-18,20-23,31,34-36H,10-12,27H2,1-4H3,(H,28,39)(H,29,38)(H,30,37)(H,32,33)/t16-,17+,18-,20+,21+,22+,23-/m1/s1 |
| InChIKey | RQPIUFLNFUDVAY-CRTOORPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillusspecies (in: firmicutes) (ncbitaxon:1409) | - | PubMed (11827035) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyloricidin B (CHEBI:212138) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3R)-3-[[(2R,3S,4S,5R)-5-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437998 | ChemSpider |