EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O6 |
| Net Charge | 0 |
| Average Mass | 358.350 |
| Monoisotopic Mass | 358.11649 |
| SMILES | C[C@H]1C2=C3[C@@H](CCN4C(=O)O[C@H]([C@H]2O)[C@H]34)ON1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H18N2O6/c1-8-12-13-11(6-7-19-14(13)16(15(12)21)25-18(19)24)26-20(8)10-4-2-9(3-5-10)17(22)23/h2-5,8,11,14-16,21H,6-7H2,1H3,(H,22,23)/t8-,11+,14-,15-,16-/m0/s1 |
| InChIKey | HFOOBTGMIDQUPB-HPNFRWIHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/j.cclet.2018.10.030) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chartrenoline (CHEBI:212114) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 4-[(1S,7R,10S,13S,14S)-14-hydroxy-10-methyl-3-oxo-2,8-dioxa-4,9-diazatetracyclo[9.2.1.04,13.07,12]tetradec-11-en-9-yl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71266906 | ChemSpider |