EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O4 |
| Net Charge | 0 |
| Average Mass | 348.483 |
| Monoisotopic Mass | 348.23006 |
| SMILES | C=C(/C=C/C(C)C(O)CC(O)CC(=C)CC)C/C=C/C(=C)CC(=O)O |
| InChI | InChI=1S/C21H32O4/c1-6-15(2)12-19(22)14-20(23)18(5)11-10-16(3)8-7-9-17(4)13-21(24)25/h7,9-11,18-20,22-23H,2-4,6,8,12-14H2,1,5H3,(H,24,25)/b9-7+,11-10+ |
| InChIKey | RHGLQKLCZHATTR-RJECPTDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aquimarinaspecies Aq78 (ncbitaxon:1191889) | - | PubMed (31308532) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cuniculene 6A (CHEBI:212101) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (4E,8E)-11,13-dihydroxy-10-methyl-3,7,15-trimethylideneheptadeca-4,8-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 88293799 | ChemSpider |