EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H30N4O4 |
| Net Charge | 0 |
| Average Mass | 510.594 |
| Monoisotopic Mass | 510.22671 |
| SMILES | O=C1Nc2ccccc2C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C30H30N4O4/c35-27-24(18-20-10-3-1-4-11-20)32-28(36)25(19-21-12-5-2-6-13-21)33-29(37)26-16-9-17-34(26)30(38)22-14-7-8-15-23(22)31-27/h1-8,10-15,24-26H,9,16-19H2,(H,31,35)(H,32,36)(H,33,37)/t24-,25-,26-/m0/s1 |
| InChIKey | CLGTZBGSAHDAKP-GSDHBNRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neosartorya (ncbitaxon:36629) | - | PubMed (27447650) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sartoryglabramide A (CHEBI:212092) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (7S,10S,13S)-10,13-dibenzyl-3,9,12,15-tetrazatricyclo[14.4.0.03,7]icosa-1(20),16,18-triene-2,8,11,14-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 58197064 | ChemSpider |