EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H25N9O3 |
| Net Charge | 0 |
| Average Mass | 355.403 |
| Monoisotopic Mass | 355.20804 |
| SMILES | CN(C(=O)C[C@@H](N)CCCN=C(N)N)[C@@H]1CN=C(NC(N)=O)NC1=O |
| InChI | InChI=1S/C13H25N9O3/c1-22(8-6-19-13(20-10(8)24)21-12(17)25)9(23)5-7(14)3-2-4-18-11(15)16/h7-8H,2-6,14H2,1H3,(H4,15,16,18)(H4,17,19,20,21,24,25)/t7-,8+/m0/s1 |
| InChIKey | ZMWBCGMRXBPXEU-JGVFFNPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Flexibacter (ncbitaxon:992) | - | PubMed (8501003) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TAN-1057B (CHEBI:212087) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S)-3-amino-N-[(5R)-2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-6-(diaminomethylideneamino)-N-methylhexanamide |
| Manual Xrefs | Databases |
|---|---|
| 110872 | ChemSpider |