EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H52N6O6 |
| Net Charge | 0 |
| Average Mass | 640.826 |
| Monoisotopic Mass | 640.39483 |
| SMILES | CC(C)C[C@H]1NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H]2CCCCN2C(=O)c2ccccc2NC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C34H52N6O6/c1-19(2)17-25-30(42)38-28(21(5)6)32(44)36-24-14-10-9-13-23(24)33(45)40-16-12-11-15-26(40)34(46)39(8)27(18-20(3)4)31(43)35-22(7)29(41)37-25/h9-10,13-14,19-22,25-28H,11-12,15-18H2,1-8H3,(H,35,43)(H,36,44)(H,37,41)(H,38,42)/t22-,25+,26+,27-,28-/m0/s1 |
| InChIKey | MFLJIVQNUIVQOL-BAVZPMSTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25789601) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Similanamide (CHEBI:212077) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (11S,14R,17S,20S,23R)-17,21-dimethyl-14,20-bis(2-methylpropyl)-11-propan-2-yl-1,9,12,15,18,21-hexazatricyclo[21.4.0.03,8]heptacosa-3,5,7-triene-2,10,13,16,19,22-hexone |
| Manual Xrefs | Databases |
|---|---|
| 35516825 | ChemSpider |