EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25NO3 |
| Net Charge | 0 |
| Average Mass | 303.402 |
| Monoisotopic Mass | 303.18344 |
| SMILES | CC(C)=C(C)CC[C@@](C)(O)[C@@H]1Cc2cc(C(=O)O)ccc2N1 |
| InChI | InChI=1S/C18H25NO3/c1-11(2)12(3)7-8-18(4,22)16-10-14-9-13(17(20)21)5-6-15(14)19-16/h5-6,9,16,19,22H,7-8,10H2,1-4H3,(H,20,21)/t16-,18+/m0/s1 |
| InChIKey | LAMDGBSFVXGCIH-FUHWJXTLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1021/jacs.8b02769) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Hydroxylbenzastatin F (CHEBI:212020) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2S)-2-[(2R)-2-hydroxy-5,6-dimethylhept-5-en-2-yl]-2,3-dihydro-1H-indole-5-carboxylic acid |