EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O3 |
| Net Charge | 0 |
| Average Mass | 288.387 |
| Monoisotopic Mass | 288.17254 |
| SMILES | CC1=C(/C=C/C=C/C(=O)O)[C@H]2[C@H](C)C[C@@](C)(O)C[C@@H]2C=C1 |
| InChI | InChI=1S/C18H24O3/c1-12-8-9-14-11-18(3,21)10-13(2)17(14)15(12)6-4-5-7-16(19)20/h4-9,13-14,17,21H,10-11H2,1-3H3,(H,19,20)/b6-4+,7-5+/t13-,14+,17+,18-/m1/s1 |
| InChIKey | WJCBQWQBAVQDHU-YIBCINBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (24605144) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tanzawaic acid L (CHEBI:212019) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(4aR,6R,8R,8aS)-6-hydroxy-2,6,8-trimethyl-5,7,8,8a-tetrahydro-4aH-naphthalen-1-yl]penta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443510 | ChemSpider |