EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H46N4O5 |
| Net Charge | 0 |
| Average Mass | 602.776 |
| Monoisotopic Mass | 602.34682 |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@@H](Cc2cnc3ccccc23)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](CC(C)C)C(=O)O1 |
| InChI | InChI=1S/C35H46N4O5/c1-5-6-12-23(4)31-20-32(40)37-29(19-25-21-36-27-16-11-10-15-26(25)27)34(42)38-28(18-24-13-8-7-9-14-24)33(41)39-30(17-22(2)3)35(43)44-31/h7-11,13-16,21-23,28-31,36H,5-6,12,17-20H2,1-4H3,(H,37,40)(H,38,42)(H,39,41)/t23-,28-,29-,30+,31-/m0/s1 |
| InChIKey | OLNIDJKACOTPMU-NLBHBUGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps javanica (ncbitaxon:43265) | - | PubMed (31921369) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Beauverolide Jb (CHEBI:211993) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,6S,9S,13S)-6-benzyl-13-[(2S)-hexan-2-yl]-9-(1H-indol-3-ylmethyl)-3-(2-methylpropyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |