EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34O8 |
| Net Charge | 0 |
| Average Mass | 474.550 |
| Monoisotopic Mass | 474.22537 |
| SMILES | C=C[C@]1(C)C[C@H]2OC[C@H]3C[C@H](OC(C)=O)[C@](C)(COC(=O)C(C)C)c4c(O)c(O)c(c2c43)[C@@H]1O |
| InChI | InChI=1S/C26H34O8/c1-7-25(5)9-15-18-17-14(10-32-15)8-16(34-13(4)27)26(6,11-33-24(31)12(2)3)20(17)22(29)21(28)19(18)23(25)30/h7,12,14-16,23,28-30H,1,8-11H2,2-6H3/t14-,15-,16+,23+,25-,26+/m1/s1 |
| InChIKey | GRQMDIMRBBXMQF-STKWRXBKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eutypellaspecies D-1 (ncbitaxon:1689458) | - | PubMed (26959036) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eutypenoid C (CHEBI:211965) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| [(1R,4S,6S,7S,12R,13S)-6-acetyloxy-13-ethenyl-9,10,12-trihydroxy-7,13-dimethyl-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-8,10,15-trien-7-yl]methyl 2-methylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 78441733 | ChemSpider |