EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O4 |
| Net Charge | 0 |
| Average Mass | 246.262 |
| Monoisotopic Mass | 246.08921 |
| SMILES | C/C=C/C=C/[C@@H]1Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C14H14O4/c1-2-3-4-5-11-7-9-6-10(15)8-12(16)13(9)14(17)18-11/h2-6,8,11,15-16H,7H2,1H3/b3-2+,5-4+/t11-/m1/s1 |
| InChIKey | OLFYYTGCAAOHGK-WANFKSSISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus thermomutatus (ncbitaxon:41047) | - | PubMed (26771621) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,8-dihydroxy-3-((1E,3E)-penta-1,3-dien-1-yl)isochroman-1-one (CHEBI:211868) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 6,8-dihydroxy-3-[(1E,3E)-penta-1,3-dienyl]-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 58196497 | ChemSpider |