EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34N2O4S2 |
| Net Charge | 0 |
| Average Mass | 466.669 |
| Monoisotopic Mass | 466.19600 |
| SMILES | CCCCCc1cccc(O)c1C1=N[C@@H]([C@H]2SC[C@@H]([C@@H](O)C(C)(C)C(=O)O)N2C)CS1 |
| InChI | InChI=1S/C23H34N2O4S2/c1-5-6-7-9-14-10-8-11-17(26)18(14)20-24-15(12-30-20)21-25(4)16(13-31-21)19(27)23(2,3)22(28)29/h8,10-11,15-16,19,21,26-27H,5-7,9,12-13H2,1-4H3,(H,28,29)/t15-,16+,19-,21-/m1/s1 |
| InChIKey | QZBCDLLHQSDFIG-NNNWTRQLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Massiliaspecies NR 4-1 (ncbitaxon:1678028) | - | PubMed (31293678) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mabetailiachelin (CHEBI:211855) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| (3S)-3-hydroxy-3-[(2R,4R)-2-[(4R)-2-(2-hydroxy-6-pentylphenyl)-4,5-dihydro-1,3-thiazol-4-yl]-3-methyl-1,3-thiazolidin-4-yl]-2,2-dimethylpropanoic acid |