EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO4 |
| Net Charge | 0 |
| Average Mass | 317.385 |
| Monoisotopic Mass | 317.16271 |
| SMILES | CC(C)C/C=C/C=C/C(=O)Nc1cc(CCC(=O)O)ccc1O |
| InChI | InChI=1S/C18H23NO4/c1-13(2)6-4-3-5-7-17(21)19-15-12-14(8-10-16(15)20)9-11-18(22)23/h3-5,7-8,10,12-13,20H,6,9,11H2,1-2H3,(H,19,21)(H,22,23)/b4-3+,7-5+ |
| InChIKey | HSOHFIDBYOOETD-BDWKERMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (24754815) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carpatamide C (CHEBI:211844) is a benzenes (CHEBI:22712) |
| Carpatamide C (CHEBI:211844) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-[4-hydroxy-3-[[(2E,4E)-7-methylocta-2,4-dienoyl]amino]phenyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 32674929 | ChemSpider |