EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H58N6O6 |
| Net Charge | 0 |
| Average Mass | 730.951 |
| Monoisotopic Mass | 730.44178 |
| SMILES | CCC(C)[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C41H58N6O6/c1-7-27(6)35-40(52)44-30(21-25(2)3)36(48)45-33(24-29-17-12-9-13-18-29)41(53)47-20-14-19-34(47)39(51)43-32(23-28-15-10-8-11-16-28)37(49)42-31(22-26(4)5)38(50)46-35/h8-13,15-18,25-27,30-35H,7,14,19-24H2,1-6H3,(H,42,49)(H,43,51)(H,44,52)(H,45,48)(H,46,50)/t27?,30-,31+,32-,33+,34+,35-/m0/s1 |
| InChIKey | RDFYNJULNCUNKD-SJZSTPBESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (11827028) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phepropeptin D (CHEBI:211831) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3R,6S,9S,12R,15S,18R)-3,15-dibenzyl-9-butan-2-yl-6,12-bis(2-methylpropyl)-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosane-2,5,8,11,14,17-hexone |
| Manual Xrefs | Databases |
|---|---|
| 78438532 | ChemSpider |