EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25Cl2N3O.2HCl |
| Net Charge | 0 |
| Average Mass | 479.279 |
| Monoisotopic Mass | 477.09082 |
| SMILES | CCN(CCCl)CCCNc1c2ccc(Cl)cc2nc2ccc(OC)cc12.[H]Cl.[H]Cl |
| InChI | InChI=1S/C21H25Cl2N3O.2ClH/c1-3-26(12-9-22)11-4-10-24-21-17-7-5-15(23)13-20(17)25-19-8-6-16(27-2)14-18(19)21;;/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,24,25);2*1H |
| InChIKey | PWGOWIIEVDAYTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICR-170 (CHEBI:21183) has part N-(2-chloroethyl)-N'-(6-chloro-2-methoxyacridin-9-yl)-N-ethylpropane-1,3-diamine (CHEBI:37594) |
| ICR-170 (CHEBI:21183) has role intercalator (CHEBI:24853) |
| ICR-170 (CHEBI:21183) is a acridines (CHEBI:22213) |
| IUPAC Name |
|---|
| N-(2-chloroethyl)-N'-(6-chloro-2-methoxyacridin-9-yl)-N-ethylpropane-1,3-diamine dihydrochloride |
| Synonyms | Source |
|---|---|
| ICR 170 | ChemIDplus |
| N-(2-chloroethyl)-N'-(6-chloro-2-methoxy-9-acridinyl)-N-ethyl-1,3-propanediamine dihydrochloride | ChemIDplus |
| acridine mustard | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:146-59-8 | ChemIDplus |