EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H.C23H28Cl3N3O.2Cl |
| Net Charge | 0 |
| Average Mass | 541.778 |
| Monoisotopic Mass | 539.08315 |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NC(C)CCCN(CCCl)CCCl)c2c1.[Cl-].[Cl-].[H+].[H+] |
| InChI | InChI=1S/C23H28Cl3N3O.2ClH/c1-16(4-3-11-29(12-9-24)13-10-25)27-23-19-7-5-17(26)14-22(19)28-21-8-6-18(30-2)15-20(21)23;;/h5-8,14-16H,3-4,9-13H2,1-2H3,(H,27,28);2*1H |
| InChIKey | JETDZFFCRPFPDH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinacrine mustard dihydrochloride (CHEBI:21182) has part quinacrine mustard (CHEBI:37595) |
| quinacrine mustard dihydrochloride (CHEBI:21182) has role intercalator (CHEBI:24853) |
| quinacrine mustard dihydrochloride (CHEBI:21182) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N1,N1-bis(2-chloroethyl)-N4-(6-chloro-2-methoxyacridin-9-yl)pentane-1,4-diamine dihydrochloride |
| Synonyms | Source |
|---|---|
| ICR 10 | ChemIDplus |
| mepacrine mustard dihydrochloride | ChemIDplus |
| quinacrine mustard dihydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3819822 | Beilstein |
| CAS:4213-45-0 | ChemIDplus |