EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H76O2 |
| Net Charge | 0 |
| Average Mass | 721.167 |
| Monoisotopic Mass | 720.58453 |
| SMILES | CC1=CCCC(C)(C)C1CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(C)CCCC(C)CCC/C(C)=C/CC1=C(C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C51H76O2/c1-37(19-13-20-38(2)22-15-24-40(4)26-17-28-42(6)33-35-48-43(7)29-18-36-51(48,9)10)21-14-23-39(3)25-16-27-41(5)32-34-45-44(8)49(52)46-30-11-12-31-47(46)50(45)53/h11-12,20,24,28-32,37,39,48H,13-19,21-23,25-27,33-36H2,1-10H3/b38-20+,40-24+,41-32+,42-28+ |
| InChIKey | RKVQPMQTSZXYJY-KPKAJMCVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiaspecies (ncbitaxon:1821) | - | PubMed (3778492) |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| II,III-Tetrahydro-omega-(2,6,6-trimethylcyclohex-2-enylmethyl)menaquinone-6 (CHEBI:211818) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| 2-[(2E,14E,18E,22E)-3,7,11,15,19,23-hexamethyl-25-(2,6,6-trimethylcyclohex-2-en-1-yl)pentacosa-2,14,18,22-tetraenyl]-3-methylnaphthalene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 4944311 | ChemSpider |