EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O |
| Net Charge | 0 |
| Average Mass | 366.589 |
| Monoisotopic Mass | 366.29227 |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3CC[C@@]4(C)c5cc(O)ccc5C[C@H]4[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C26H38O/c1-23(2)11-6-12-25(4)20(23)9-14-26(5)21(25)10-13-24(3)19-16-18(27)8-7-17(19)15-22(24)26/h7-8,16,20-22,27H,6,9-15H2,1-5H3/t20-,21+,22+,24-,25-,26+/m0/s1 |
| InChIKey | FUFDFVFIOVENBX-DINBMMLPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phytohabitans (ncbitaxon:907364) | - | PubMed (24916894) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Habiterpenol (CHEBI:211807) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (4aS,4bR,6aR,11aS,11bR,13aS)-1,1,4a,6a,11b-pentamethyl-3,4,4b,5,6,11,11a,12,13,13a-decahydro-2H-indeno[2,1-a]phenanthren-8-ol |
| Manual Xrefs | Databases |
|---|---|
| 78438530 | ChemSpider |