EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO4 |
| Net Charge | 0 |
| Average Mass | 305.374 |
| Monoisotopic Mass | 305.16271 |
| SMILES | CC(C)(O)[C@H]1CC[C@@](C)(O)[C@@H]2Cc3cc(C(=O)O)ccc3N21 |
| InChI | InChI=1S/C17H23NO4/c1-16(2,21)13-6-7-17(3,22)14-9-11-8-10(15(19)20)4-5-12(11)18(13)14/h4-5,8,13-14,21-22H,6-7,9H2,1-3H3,(H,19,20)/t13-,14+,17-/m1/s1 |
| InChIKey | FPQVKUQAXFGZIE-JKIFEVAISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1177/1934578X19861791) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aminobenzoate D (CHEBI:211795) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (6R,9R,9aS)-9-hydroxy-6-(2-hydroxypropan-2-yl)-9-methyl-7,8,9a,10-tetrahydro-6H-pyrido[1,2-a]indole-2-carboxylic acid |