EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO5 |
| Net Charge | 0 |
| Average Mass | 321.373 |
| Monoisotopic Mass | 321.15762 |
| SMILES | CC[C@@H](Cc1ccc(NC(C)=O)c(O)c1)[C@@H](O)C/C=C/C(=O)O |
| InChI | InChI=1S/C17H23NO5/c1-3-13(15(20)5-4-6-17(22)23)9-12-7-8-14(16(21)10-12)18-11(2)19/h4,6-8,10,13,15,20-21H,3,5,9H2,1-2H3,(H,18,19)(H,22,23)/b6-4+/t13-,15-/m0/s1 |
| InChIKey | PLAXVPYBGNWOPG-VZFYUFDISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1177/1934578X19861791) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aminobenzoate C (CHEBI:211790) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E,5S,6S)-6-[(4-acetamido-3-hydroxyphenyl)methyl]-5-hydroxyoct-2-enoic acid |