EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N4O6 |
| Net Charge | 0 |
| Average Mass | 380.401 |
| Monoisotopic Mass | 380.16958 |
| SMILES | NCCCC(NC(=O)c1cccc(O)c1O)C(=O)NC1CCCN(O)C1=O |
| InChI | InChI=1S/C17H24N4O6/c18-8-2-5-11(16(25)20-12-6-3-9-21(27)17(12)26)19-15(24)10-4-1-7-13(22)14(10)23/h1,4,7,11-12,22-23,27H,2-3,5-6,8-9,18H2,(H,19,24)(H,20,25) |
| InChIKey | WRZPMVMHSJTCJE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomyces (ncbitaxon:1654) | - | PubMed (27299545) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cutinostatin B (CHEBI:211759) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N-[5-amino-1-[(1-hydroxy-2-oxopiperidin-3-yl)amino]-1-oxopentan-2-yl]-2,3-dihydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 78434987 | ChemSpider |