EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O4 |
| Net Charge | 0 |
| Average Mass | 266.297 |
| Monoisotopic Mass | 266.12666 |
| SMILES | COC(=O)CNC(=O)c1ccc(CC[C@H](C)O)cn1 |
| InChI | InChI=1S/C13H18N2O4/c1-9(16)3-4-10-5-6-11(14-7-10)13(18)15-8-12(17)19-2/h5-7,9,16H,3-4,8H2,1-2H3,(H,15,18)/t9-/m0/s1 |
| InChIKey | AFHZRVUWHGTZOB-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria (ncbitaxon:5598) | - | DOI (10.1177/1934578X19844116) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Atransfusarin (CHEBI:211725) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl 2-[[5-[(3S)-3-hydroxybutyl]pyridine-2-carbonyl]amino]acetate |