EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40N4O4 |
| Net Charge | 0 |
| Average Mass | 496.652 |
| Monoisotopic Mass | 496.30496 |
| SMILES | CC(=O)N[C@H](C(=O)N(C)[C@H](C(=O)N/C=C\[C@]1(CC=C(C)C)C(=O)Nc2ccccc21)C(C)C)C(C)C |
| InChI | InChI=1S/C28H40N4O4/c1-17(2)13-14-28(21-11-9-10-12-22(21)31-27(28)36)15-16-29-25(34)24(19(5)6)32(8)26(35)23(18(3)4)30-20(7)33/h9-13,15-16,18-19,23-24H,14H2,1-8H3,(H,29,34)(H,30,33)(H,31,36)/b16-15-/t23-,24-,28-/m0/s1 |
| InChIKey | RVCGZLLNFZYJTG-AUDVIQTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (18846581) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Terpeptin B (CHEBI:211710) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-N,3-dimethyl-N-[(2S)-3-methyl-1-[[(Z)-2-[(3S)-3-(3-methylbut-2-enyl)-2-oxo-1H-indol-3-yl]ethenyl]amino]-1-oxobutan-2-yl]butanamide |
| Manual Xrefs | Databases |
|---|---|
| 27023431 | ChemSpider |