EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N2O5S |
| Net Charge | 0 |
| Average Mass | 380.466 |
| Monoisotopic Mass | 380.14059 |
| SMILES | COc1cc(C(=O)O)nc(-c2csc(CCCCC(C)(C)O)n2)c1OC |
| InChI | InChI=1S/C18H24N2O5S/c1-18(2,23)8-6-5-7-14-19-12(10-26-14)15-16(25-4)13(24-3)9-11(20-15)17(21)22/h9-10,23H,5-8H2,1-4H3,(H,21,22) |
| InChIKey | XAJOGJGSQJPCNH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharothrix (ncbitaxon:2071) | - | PubMed (7490208) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WS75624 A (CHEBI:211697) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| IUPAC Name |
|---|
| 6-[2-(5-hydroxy-5-methylhexyl)-1,3-thiazol-4-yl]-4,5-dimethoxypyridine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8105409 | ChemSpider |