EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H39NO6 |
| Net Charge | 0 |
| Average Mass | 449.588 |
| Monoisotopic Mass | 449.27774 |
| SMILES | COC1CC(=O)[C@@]23C(=O)N[C@@H](CC(C)C)[C@@H]2C(C)=C(C)[C@H](O)[C@@H]3/C=C(\C)CCC(O)C1O |
| InChI | InChI=1S/C25H39NO6/c1-12(2)9-17-21-14(4)15(5)22(29)16-10-13(3)7-8-18(27)23(30)19(32-6)11-20(28)25(16,21)24(31)26-17/h10,12,16-19,21-23,27,29-30H,7-9,11H2,1-6H3,(H,26,31)/b13-10+/t16-,17-,18?,19?,21-,22-,23?,25+/m0/s1 |
| InChIKey | SEJALNVFDONJGO-GXVMMTHKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | PubMed (15981416) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspochalasin L (CHEBI:211676) has role fungal metabolite (CHEBI:76946) |
| Aspochalasin L (CHEBI:211676) is a cytochalasin (CHEBI:23528) |
| IUPAC Name |
|---|
| (1R,9E,11R,12R,15R,16S)-5,6,12-trihydroxy-4-methoxy-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,13-diene-2,18-dione |
| Manual Xrefs | Databases |
|---|---|
| 9571651 | ChemSpider |