EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N7O5 |
| Net Charge | 0 |
| Average Mass | 381.393 |
| Monoisotopic Mass | 381.17607 |
| SMILES | NC(N)=NC[C@@H](CC(=O)N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O)N=C(N)N |
| InChI | InChI=1S/C15H23N7O5/c16-14(17)20-6-8(21-15(18)19)5-12(25)22-9(13(26)27)3-7-1-2-10(23)11(24)4-7/h1-2,4,8-9,23-24H,3,5-6H2,(H,22,25)(H,26,27)(H4,16,17,20)(H4,18,19,21)/t8-,9+/m1/s1 |
| InChIKey | RLNWXLRRKGMRGE-BDAKNGLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isaria japonica (ncbitaxon:72233) | - | DOI (10.1016/j.tet.2009.06.069) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hanasanagin (CHEBI:211598) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(3R)-3,4-bis(diaminomethylideneamino)butanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28286618 | ChemSpider |