EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O7 |
| Net Charge | 0 |
| Average Mass | 462.583 |
| Monoisotopic Mass | 462.26175 |
| SMILES | C=C1CC[C@H]2C(C)(C)[C@H](O)CC[C@]2(C)[C@H]1C[C@]12O[C@H]1[C@H](O)C(COC(=O)C[C@H](C)O)=CC2=O |
| InChI | InChI=1S/C26H38O7/c1-14-6-7-18-24(3,4)19(28)8-9-25(18,5)17(14)12-26-20(29)11-16(22(31)23(26)33-26)13-32-21(30)10-15(2)27/h11,15,17-19,22-23,27-28,31H,1,6-10,12-13H2,2-5H3/t15-,17-,18-,19+,22+,23-,25+,26+/m0/s1 |
| InChIKey | NGHPKQFMKLMMHD-IBVHSBIOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichodermaspecies 1212-03 (ncbitaxon:1421414) | - | DOI (10.1016/j.tet.2013.12.087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Neomacrophorin III (CHEBI:211595) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| [(1S,2R,6S)-6-[[(1S,4aR,6R,8aR)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-2-hydroxy-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl (3S)-3-hydroxybutanoate |