EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O5 |
| Net Charge | 0 |
| Average Mass | 346.423 |
| Monoisotopic Mass | 346.17802 |
| SMILES | COC(=O)[C@]1(O)C(=O)c2c(O)cc(C)cc2[C@H]2[C@@H](C(C)C)CC[C@]21C |
| InChI | InChI=1S/C20H26O5/c1-10(2)12-6-7-19(4)16(12)13-8-11(3)9-14(21)15(13)17(22)20(19,24)18(23)25-5/h8-10,12,16,21,24H,6-7H2,1-5H3/t12-,16-,19-,20-/m1/s1 |
| InChIKey | NIVOQQYVGQDRLU-DJGFWBNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hamigera (ncbitaxon:39196) | - | DOI (10.1021/np9903494) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Debromohamigeran A (CHEBI:211586) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| methyl (1R,3aR,4R,9bR)-4,6-dihydroxy-3a,8-dimethyl-5-oxo-1-propan-2-yl-1,2,3,9b-tetrahydrocyclopenta[a]naphthalene-4-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 8982847 | ChemSpider |