EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O7S |
| Net Charge | 0 |
| Average Mass | 358.372 |
| Monoisotopic Mass | 358.08347 |
| SMILES | CC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)CCCC(O)C(=O)O)[C@H]2SC1 |
| InChI | InChI=1S/C14H18N2O7S/c1-6-5-24-12-9(11(19)16(12)10(6)14(22)23)15-8(18)4-2-3-7(17)13(20)21/h7,9,12,17H,2-5H2,1H3,(H,15,18)(H,20,21)(H,22,23)/t7?,9-,12-/m1/s1 |
| InChIKey | RMLHKIIIPXZPPX-XTOKZYMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | - | PubMed (7775275) |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-Hydroxyadipoyl-7-ADCA (CHEBI:211580) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| (6R,7R)-7-[(5-carboxy-5-hydroxypentanoyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8603891 | ChemSpider |