EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27NO5 |
| Net Charge | 0 |
| Average Mass | 349.427 |
| Monoisotopic Mass | 349.18892 |
| SMILES | O=C(O)CCCCCC/C=C/C(=O)N[C@H](CO)Cc1ccccc1O |
| InChI | InChI=1S/C19H27NO5/c21-14-16(13-15-9-7-8-10-17(15)22)20-18(23)11-5-3-1-2-4-6-12-19(24)25/h5,7-11,16,21-22H,1-4,6,12-14H2,(H,20,23)(H,24,25)/b11-5+/t16-/m0/s1 |
| InChIKey | DSGPWSYQJVLDOV-WQRDJFRPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps (ncbitaxon:45234) | - | PubMed (31629870) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cordytakaoamide B (CHEBI:211576) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (E)-10-[[(2S)-1-hydroxy-3-(2-hydroxyphenyl)propan-2-yl]amino]-10-oxodec-8-enoic acid |