EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO4 |
| Net Charge | 0 |
| Average Mass | 305.374 |
| Monoisotopic Mass | 305.16271 |
| SMILES | O=C(O)CCCC/C=C/C(=O)N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c19-13-15(12-14-8-4-3-5-9-14)18-16(20)10-6-1-2-7-11-17(21)22/h3-6,8-10,15,19H,1-2,7,11-13H2,(H,18,20)(H,21,22)/b10-6+/t15-/m0/s1 |
| InChIKey | OBGVLVABDWILDP-WGPYJDKQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps (ncbitaxon:45234) | - | PubMed (31629870) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cordytakaoamide A (CHEBI:211569) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (E)-8-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-8-oxooct-6-enoic acid |