EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | O=C(O)c1ccccc1NCCO |
| InChI | InChI=1S/C9H11NO3/c11-6-5-10-8-4-2-1-3-7(8)9(12)13/h1-4,10-11H,5-6H2,(H,12,13) |
| InChIKey | KULNOANNPOGHQK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps (ncbitaxon:45234) | - | PubMed (31629870) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-((2-hydroxyethyl)amino)benzoic acid (CHEBI:211564) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 2-(2-hydroxyethylamino)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 105124 | ChemSpider |