EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O5 |
| Net Charge | 0 |
| Average Mass | 364.482 |
| Monoisotopic Mass | 364.22497 |
| SMILES | CC(=O)[C@H]1CC[C@H]2C3=C(CC[C@]12C)[C@@](C)(CCC(=O)O)[C@H](CO)[C@H](O)C3 |
| InChI | InChI=1S/C21H32O5/c1-12(23)14-4-5-15-13-10-18(24)17(11-22)21(3,9-7-19(25)26)16(13)6-8-20(14,15)2/h14-15,17-18,22,24H,4-11H2,1-3H3,(H,25,26)/t14-,15+,17-,18-,20-,21-/m1/s1 |
| InChIKey | YNMLSPGNWXNXLY-PEOYNUHJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulisporiumspecies (ncbitaxon:1897413) | - | DOI (10.1016/j.tet.2018.08.011) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nodulisporisteroid P (CHEBI:211542) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| 3-[(3S,3aS,6S,7R,8R,9bR)-3-acetyl-8-hydroxy-7-(hydroxymethyl)-3a,6-dimethyl-2,3,4,5,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439201 | ChemSpider |