EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O3 |
| Net Charge | 0 |
| Average Mass | 216.236 |
| Monoisotopic Mass | 216.07864 |
| SMILES | C=C=CCOc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C13H12O3/c1-2-3-10-16-12-7-4-11(5-8-12)6-9-13(14)15/h3-9H,1,10H2,(H,14,15)/b9-6+ |
| InChIKey | KQIPPZMDZCTQNT-RMKNXTFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | DOI (10.1016/s0040-4039(00)01948-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| But-2,3-dienyl ether of p-hydroxycinnamic acid (CHEBI:211535) is a cinnamic acids (CHEBI:23252) |
| Manual Xrefs | Databases |
|---|---|
| 10478465 | ChemSpider |