EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O7 |
| Net Charge | 0 |
| Average Mass | 394.464 |
| Monoisotopic Mass | 394.19915 |
| SMILES | C[C@]12CCC3=C(CC(=O)[C@@H]([C@@H](O)CO)[C@]3(C)CCC(=O)O)[C@@H]1CC[C@@H]2C(=O)O |
| InChI | InChI=1S/C21H30O7/c1-20-7-5-13-11(12(20)3-4-14(20)19(27)28)9-15(23)18(16(24)10-22)21(13,2)8-6-17(25)26/h12,14,16,18,22,24H,3-10H2,1-2H3,(H,25,26)(H,27,28)/t12-,14+,16-,18-,20-,21+/m0/s1 |
| InChIKey | ZWUWJKRACXICAP-VVXYRTGMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulisporiumspecies (ncbitaxon:1897413) | - | DOI (10.1016/j.tet.2018.08.011) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nodulisporisteroid M (CHEBI:211517) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| (3S,3aS,6S,7R,9bR)-6-(2-carboxyethyl)-7-[(1R)-1,2-dihydroxyethyl]-3a,6-dimethyl-8-oxo-1,2,3,4,5,7,9,9b-octahydrocyclopenta[a]naphthalene-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439197 | ChemSpider |